About 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 63595986) has the molecular formula C15H18FN3OS
and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline.
Molecular Properties
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline |
| PubChem CID | 63595986 |
| Molecular Formula | C15H18FN3OS |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | Cc1cc(C)nc(Sc2cc(OC(C)C)c(F)cc2N)n1 |
| InChI | InChI=1S/C15H18FN3OS/c1-8(2)20-13-7-14(12(17)6-11(13)16)21-15-18-9(3)5-10(4)19-15/h5-8H,17H2,1-4H3 |
| InChIKey | ZMZAPEFTIMLRBR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline?
The IUPAC name of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline (CID 63595986) is 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline.
What is the SMILES notation for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline?
The canonical SMILES for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline is Cc1cc(C)nc(Sc2cc(OC(C)C)c(F)cc2N)n1.
What is the InChIKey of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline?
The InChIKey is ZMZAPEFTIMLRBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18FN3OS/c1-8(2)20-13-7-14(12(17)6-11(13)16)21-15-18-9(3)5-10(4)19-15/h5-8H,17H2,1-4H3.
What are the key properties of 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline?
2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline has a molecular weight of 307.39 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethylpyrimidin-2-yl)sulfanyl-5-fluoro-4-propan-2-yloxyaniline is sourced from PubChem (CID 63595986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).