About 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one
4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one (PubChem CID 63596626) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one |
| PubChem CID | 63596626 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1CCN |
| InChI | InChI=1S/C8H17N3O/c1-8(2)7(12)10-4-6-11(8)5-3-9/h3-6,9H2,1-2H3,(H,10,12) |
| InChIKey | CWFHGLRAJPMHCK-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one?
The IUPAC name of 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one (CID 63596626) is 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one.
What is the SMILES notation for 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one?
The canonical SMILES for 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one is CC1(C)C(=O)NCCN1CCN.
What is the InChIKey of 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one?
The InChIKey is CWFHGLRAJPMHCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O/c1-8(2)7(12)10-4-6-11(8)5-3-9/h3-6,9H2,1-2H3,(H,10,12).
What are the key properties of 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one?
4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one has a molecular weight of 171.24 g/mol, XLogP of -0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-3,3-dimethylpiperazin-2-one is sourced from PubChem (CID 63596626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).