C12H14FN3O2 — CID 63596987
4-(4-amino-2-fluorobenzoyl)-3-methylpiperazin-2-one (PubChem CID 63596987) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 4-(4-amino-2-fluorobenzoyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(4-amino-2-fluorobenzoyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 63596987 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-(4-amino-2-fluorobenzoyl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)c1ccc(N)cc1F |
| InChI | InChI=1S/C12H14FN3O2/c1-7-11(17)15-4-5-16(7)12(18)9-3-2-8(14)6-10(9)13/h2-3,6-7H,4-5,14H2,1H3,(H,15,17) |
| InChIKey | LKQUGUWLNJYMKS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|