C15H20N4O2 — CID 63597041
6-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one (PubChem CID 63597041) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one.
| Compound Name | 6-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 63597041 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-(2,2-dimethyl-3-oxopiperazin-1-yl)-3-(methylamino)-1,3-dihydroindol-2-one |
| SMILES | CNC1C(=O)Nc2cc(N3CCNC(=O)C3(C)C)ccc21 |
| InChI | InChI=1S/C15H20N4O2/c1-15(2)14(21)17-6-7-19(15)9-4-5-10-11(8-9)18-13(20)12(10)16-3/h4-5,8,12,16H,6-7H2,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | UHSQXBCNGWLXOV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|