C14H20FN3O3 — CID 63597808
1-[1-(4-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylmethanamine (PubChem CID 63597808) has the molecular formula C14H20FN3O3 and a molecular weight of 297.33 g/mol. Its IUPAC name is 1-[1-(4-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylmethanamine.
| Compound Name | 1-[1-(4-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63597808 |
| Molecular Formula | C14H20FN3O3 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-[1-(4-fluoro-5-methoxy-2-nitrophenyl)piperidin-4-yl]-N-methylmethanamine |
| SMILES | CNCC1CCN(c2cc(OC)c(F)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H20FN3O3/c1-16-9-10-3-5-17(6-4-10)12-8-14(21-2)11(15)7-13(12)18(19)20/h7-8,10,16H,3-6,9H2,1-2H3 |
| InChIKey | UNCZXQIJBBVYRT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|