About 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine
1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine (PubChem CID 6359786) has the molecular formula C15H26N2O2S
and a molecular weight of 298.45 g/mol. Its IUPAC name is 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine.
Molecular Properties
| Compound Name | 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine |
| PubChem CID | 6359786 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine |
| SMILES | CCCS(=O)(=O)N1CCN(C[C@@H]2C[C@@H]3C=C[C@@H]2C3)CC1 |
| InChI | InChI=1S/C15H26N2O2S/c1-2-9-20(18,19)17-7-5-16(6-8-17)12-15-11-13-3-4-14(15)10-13/h3-4,13-15H,2,5-12H2,1H3/t13-,14-,15+/m1/s1 |
| InChIKey | CYXYNMSOFRFXOP-KFWWJZLASA-N |
| XLogP | 1.56 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine?
The IUPAC name of 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine (CID 6359786) is 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine.
What is the SMILES notation for 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine?
The canonical SMILES for 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine is CCCS(=O)(=O)N1CCN(C[C@@H]2C[C@@H]3C=C[C@@H]2C3)CC1.
What is the InChIKey of 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine?
The InChIKey is CYXYNMSOFRFXOP-KFWWJZLASA-N. The full InChI is InChI=1S/C15H26N2O2S/c1-2-9-20(18,19)17-7-5-16(6-8-17)12-15-11-13-3-4-14(15)10-13/h3-4,13-15H,2,5-12H2,1H3/t13-,14-,15+/m1/s1.
What are the key properties of 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine?
1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine has a molecular weight of 298.45 g/mol, XLogP of 1.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-propylsulfonylpiperazine is sourced from PubChem (CID 6359786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).