C12H17N3O2S — CID 63600820
3-ethyl-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]piperazin-2-one (PubChem CID 63600820) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-ethyl-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]piperazin-2-one.
| Compound Name | 3-ethyl-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 63600820 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-ethyl-4-[2-(2-methyl-1,3-thiazol-4-yl)acetyl]piperazin-2-one |
| SMILES | CCC1C(=O)NCCN1C(=O)Cc1csc(C)n1 |
| InChI | InChI=1S/C12H17N3O2S/c1-3-10-12(17)13-4-5-15(10)11(16)6-9-7-18-8(2)14-9/h7,10H,3-6H2,1-2H3,(H,13,17) |
| InChIKey | IHWCVWRPZGEMRE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |