C11H17N5O3S — CID 63603348
3-ethyl-4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]piperazin-2-one (PubChem CID 63603348) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-ethyl-4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]piperazin-2-one.
| Compound Name | 3-ethyl-4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]piperazin-2-one |
|---|---|
| PubChem CID | 63603348 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-ethyl-4-[(2-hydrazinyl-3-pyridinyl)sulfonyl]piperazin-2-one |
| SMILES | CCC1C(=O)NCCN1S(=O)(=O)c1cccnc1NN |
| InChI | InChI=1S/C11H17N5O3S/c1-2-8-11(17)14-6-7-16(8)20(18,19)9-4-3-5-13-10(9)15-12/h3-5,8H,2,6-7,12H2,1H3,(H,13,15)(H,14,17) |
| InChIKey | QLRAKKRGWSPNRI-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|