C15H21N3O3 — CID 63604057
3-[(3,4-dimethylpiperazine-1-carbonyl)amino]-2-methylbenzoic acid (PubChem CID 63604057) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[(3,4-dimethylpiperazine-1-carbonyl)amino]-2-methylbenzoic acid.
| Compound Name | 3-[(3,4-dimethylpiperazine-1-carbonyl)amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 63604057 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[(3,4-dimethylpiperazine-1-carbonyl)amino]-2-methylbenzoic acid |
| SMILES | Cc1c(NC(=O)N2CCN(C)C(C)C2)cccc1C(=O)O |
| InChI | InChI=1S/C15H21N3O3/c1-10-9-18(8-7-17(10)3)15(21)16-13-6-4-5-12(11(13)2)14(19)20/h4-6,10H,7-9H2,1-3H3,(H,16,21)(H,19,20) |
| InChIKey | HQPSZYCKQVJGNA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |