C14H22ClN3 — CID 63605366
2-(4-chlorophenyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine (PubChem CID 63605366) has the molecular formula C14H22ClN3 and a molecular weight of 267.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(4-chlorophenyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 63605366 |
| Molecular Formula | C14H22ClN3 |
| Molecular Weight | 267.80 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(3,4-dimethylpiperazin-1-yl)ethanamine |
| SMILES | CC1CN(C(CN)c2ccc(Cl)cc2)CCN1C |
| InChI | InChI=1S/C14H22ClN3/c1-11-10-18(8-7-17(11)2)14(9-16)12-3-5-13(15)6-4-12/h3-6,11,14H,7-10,16H2,1-2H3 |
| InChIKey | IBLBBCVPTCMKTA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.80 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |