About 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one
4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one (PubChem CID 63606215) has the molecular formula C14H19N3O4
and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one |
| PubChem CID | 63606215 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1C(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H19N3O4/c1-8-13(20)16-4-5-17(8)14(21)10(15)6-9-2-3-11(18)12(19)7-9/h2-3,7-8,10,18-19H,4-6,15H2,1H3,(H,16,20)/t8?,10-/m0/s1 |
| InChIKey | AEQCALUHSAOHIX-HTLJXXAVSA-N |
| XLogP | -0.69 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one?
The IUPAC name of 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one (CID 63606215) is 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one.
What is the SMILES notation for 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one?
The canonical SMILES for 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one is CC1C(=O)NCCN1C(=O)[C@@H](N)Cc1ccc(O)c(O)c1.
What is the InChIKey of 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one?
The InChIKey is AEQCALUHSAOHIX-HTLJXXAVSA-N. The full InChI is InChI=1S/C14H19N3O4/c1-8-13(20)16-4-5-17(8)14(21)10(15)6-9-2-3-11(18)12(19)7-9/h2-3,7-8,10,18-19H,4-6,15H2,1H3,(H,16,20)/t8?,10-/m0/s1.
What are the key properties of 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one?
4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one has a molecular weight of 293.32 g/mol, XLogP of -0.69, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoyl]-3-methylpiperazin-2-one is sourced from PubChem (CID 63606215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).