3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid

C9H16N2O5S — CID 63606656

IUPAC3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid
SMILESCC1(C)C(=O)NCCN1S(=O)(=O)CCC(=O)O
InChIInChI=1S/C9H16N2O5S/c1-9(2)8(14)10-4-5-11(9)17(15,16)6-3-7(12)13/h3-6H2,1-2H3,(H,10,14)(H,12,13)
InChIKeyBPFQXJAXLURMSQ-UHFFFAOYSA-N
MW264.30 g/mol
LogP-1.00
Rot. Bonds4

About 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid

3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid (PubChem CID 63606656) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid.

Molecular Properties

Compound Name3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid
PubChem CID63606656
Molecular FormulaC9H16N2O5S
Molecular Weight264.30 g/mol
Exact Mass264.08
IUPAC Name3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid
SMILESCC1(C)C(=O)NCCN1S(=O)(=O)CCC(=O)O
InChIInChI=1S/C9H16N2O5S/c1-9(2)8(14)10-4-5-11(9)17(15,16)6-3-7(12)13/h3-6H2,1-2H3,(H,10,14)(H,12,13)
InChIKeyBPFQXJAXLURMSQ-UHFFFAOYSA-N
XLogP-1.00
TPSA103.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.30
LogP ≤ 5-1.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid?
The IUPAC name of 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid (CID 63606656) is 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid.
What is the SMILES notation for 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid?
The canonical SMILES for 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid is CC1(C)C(=O)NCCN1S(=O)(=O)CCC(=O)O.
What is the InChIKey of 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid?
The InChIKey is BPFQXJAXLURMSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O5S/c1-9(2)8(14)10-4-5-11(9)17(15,16)6-3-7(12)13/h3-6H2,1-2H3,(H,10,14)(H,12,13).
What are the key properties of 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid?
3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid has a molecular weight of 264.30 g/mol, XLogP of -1.00, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethyl-3-oxopiperazin-1-yl)sulfonylpropanoic acid is sourced from PubChem (CID 63606656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).