About 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one
4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one (PubChem CID 63606845) has the molecular formula C13H25N3O
and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one |
| PubChem CID | 63606845 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C1CCCCCC1N |
| InChI | InChI=1S/C13H25N3O/c1-13(2)12(17)15-8-9-16(13)11-7-5-3-4-6-10(11)14/h10-11H,3-9,14H2,1-2H3,(H,15,17) |
| InChIKey | KMZXOSNKUGDDLN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one?
The IUPAC name of 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one (CID 63606845) is 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one.
What is the SMILES notation for 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one?
The canonical SMILES for 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one is CC1(C)C(=O)NCCN1C1CCCCCC1N.
What is the InChIKey of 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one?
The InChIKey is KMZXOSNKUGDDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O/c1-13(2)12(17)15-8-9-16(13)11-7-5-3-4-6-10(11)14/h10-11H,3-9,14H2,1-2H3,(H,15,17).
What are the key properties of 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one?
4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one has a molecular weight of 239.36 g/mol, XLogP of 0.86, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminocycloheptyl)-3,3-dimethylpiperazin-2-one is sourced from PubChem (CID 63606845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).