C31H16F6N2O4 — CID 636075
5-[3-(1,3-dioxo-2-phenylisoindol-5-yl)-1,1,2,2,3,3-hexafluoropropyl]-2-phenylisoindole-1,3-dione (PubChem CID 636075) has the molecular formula C31H16F6N2O4 and a molecular weight of 594.47 g/mol. Its IUPAC name is 5-[3-(1,3-dioxo-2-phenylisoindol-5-yl)-1,1,2,2,3,3-hexafluoropropyl]-2-phenylisoindole-1,3-dione.
| Compound Name | 5-[3-(1,3-dioxo-2-phenylisoindol-5-yl)-1,1,2,2,3,3-hexafluoropropyl]-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 636075 |
| Molecular Formula | C31H16F6N2O4 |
| Molecular Weight | 594.47 g/mol |
| Exact Mass | 594.10 |
| IUPAC Name | 5-[3-(1,3-dioxo-2-phenylisoindol-5-yl)-1,1,2,2,3,3-hexafluoropropyl]-2-phenylisoindole-1,3-dione |
| SMILES | O=C1c2ccc(C(F)(F)C(F)(F)C(F)(F)c3ccc4c(c3)C(=O)N(c3ccccc3)C4=O)cc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C31H16F6N2O4/c32-29(33,17-11-13-21-23(15-17)27(42)38(25(21)40)19-7-3-1-4-8-19)31(36,37)30(34,35)18-12-14-22-24(16-18)28(43)39(26(22)41)20-9-5-2-6-10-20/h1-16H |
| InChIKey | RTPUUXTTZZRLLT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.47 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|