About 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one
4-ethylsulfonyl-3,3-dimethylpiperazin-2-one (PubChem CID 63607786) has the molecular formula C8H16N2O3S
and a molecular weight of 220.29 g/mol. Its IUPAC name is 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one |
| PubChem CID | 63607786 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one |
| SMILES | CCS(=O)(=O)N1CCNC(=O)C1(C)C |
| InChI | InChI=1S/C8H16N2O3S/c1-4-14(12,13)10-6-5-9-7(11)8(10,2)3/h4-6H2,1-3H3,(H,9,11) |
| InChIKey | LYRAPASVRBLOFY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one?
The IUPAC name of 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one (CID 63607786) is 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one.
What is the SMILES notation for 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one?
The canonical SMILES for 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one is CCS(=O)(=O)N1CCNC(=O)C1(C)C.
What is the InChIKey of 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one?
The InChIKey is LYRAPASVRBLOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3S/c1-4-14(12,13)10-6-5-9-7(11)8(10,2)3/h4-6H2,1-3H3,(H,9,11).
What are the key properties of 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one?
4-ethylsulfonyl-3,3-dimethylpiperazin-2-one has a molecular weight of 220.29 g/mol, XLogP of -0.45, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfonyl-3,3-dimethylpiperazin-2-one is sourced from PubChem (CID 63607786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).