C6H10F2N2O3S — CID 63607965
4-(difluoromethylsulfonyl)-3-methylpiperazin-2-one (PubChem CID 63607965) has the molecular formula C6H10F2N2O3S and a molecular weight of 228.22 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-3-methylpiperazin-2-one.
| Compound Name | 4-(difluoromethylsulfonyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 63607965 |
| Molecular Formula | C6H10F2N2O3S |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C6H10F2N2O3S/c1-4-5(11)9-2-3-10(4)14(12,13)6(7)8/h4,6H,2-3H2,1H3,(H,9,11) |
| InChIKey | LPDJRKRMBCMKPO-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |