C12H25N3O — CID 63608638
4-[(3,4-dimethylpiperazin-1-yl)methyl]piperidin-4-ol (PubChem CID 63608638) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-[(3,4-dimethylpiperazin-1-yl)methyl]piperidin-4-ol.
| Compound Name | 4-[(3,4-dimethylpiperazin-1-yl)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 63608638 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 4-[(3,4-dimethylpiperazin-1-yl)methyl]piperidin-4-ol |
| SMILES | CC1CN(CC2(O)CCNCC2)CCN1C |
| InChI | InChI=1S/C12H25N3O/c1-11-9-15(8-7-14(11)2)10-12(16)3-5-13-6-4-12/h11,13,16H,3-10H2,1-2H3 |
| InChIKey | VELXUWHVJPQKCP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |