About 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one
1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one (PubChem CID 63608644) has the molecular formula C14H28N4O
and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one |
| PubChem CID | 63608644 |
| Molecular Formula | C14H28N4O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.23 |
| IUPAC Name | 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one |
| SMILES | CN1CCN(CCC(=O)N2CCNCC2)CC1(C)C |
| InChI | InChI=1S/C14H28N4O/c1-14(2)12-17(11-10-16(14)3)7-4-13(19)18-8-5-15-6-9-18/h15H,4-12H2,1-3H3 |
| InChIKey | FUYJYWOWKXALGV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one?
The IUPAC name of 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one (CID 63608644) is 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one.
What is the SMILES notation for 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one?
The canonical SMILES for 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one is CN1CCN(CCC(=O)N2CCNCC2)CC1(C)C.
What is the InChIKey of 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one?
The InChIKey is FUYJYWOWKXALGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O/c1-14(2)12-17(11-10-16(14)3)7-4-13(19)18-8-5-15-6-9-18/h15H,4-12H2,1-3H3.
What are the key properties of 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one?
1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one has a molecular weight of 268.40 g/mol, XLogP of -0.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-yl-3-(3,3,4-trimethylpiperazin-1-yl)propan-1-one is sourced from PubChem (CID 63608644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).