About 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol
1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol (PubChem CID 63608756) has the molecular formula C12H27N3O
and a molecular weight of 229.37 g/mol. Its IUPAC name is 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol |
| PubChem CID | 63608756 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol |
| SMILES | CCNCC(O)CN1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H27N3O/c1-5-13-8-11(16)9-15-7-6-14(4)12(2,3)10-15/h11,13,16H,5-10H2,1-4H3 |
| InChIKey | AGPRHDCTANWBOY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol?
The IUPAC name of 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol (CID 63608756) is 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol.
What is the SMILES notation for 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol?
The canonical SMILES for 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol is CCNCC(O)CN1CCN(C)C(C)(C)C1.
What is the InChIKey of 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol?
The InChIKey is AGPRHDCTANWBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N3O/c1-5-13-8-11(16)9-15-7-6-14(4)12(2,3)10-15/h11,13,16H,5-10H2,1-4H3.
What are the key properties of 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol?
1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol has a molecular weight of 229.37 g/mol, XLogP of -0.02, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethylamino)-3-(3,3,4-trimethylpiperazin-1-yl)propan-2-ol is sourced from PubChem (CID 63608756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).