C13H17FN2O — CID 63609216
4-(3,4-dimethylpiperazin-1-yl)-3-fluorobenzaldehyde (PubChem CID 63609216) has the molecular formula C13H17FN2O and a molecular weight of 236.29 g/mol. Its IUPAC name is 4-(3,4-dimethylpiperazin-1-yl)-3-fluorobenzaldehyde.
| Compound Name | 4-(3,4-dimethylpiperazin-1-yl)-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 63609216 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 4-(3,4-dimethylpiperazin-1-yl)-3-fluorobenzaldehyde |
| SMILES | CC1CN(c2ccc(C=O)cc2F)CCN1C |
| InChI | InChI=1S/C13H17FN2O/c1-10-8-16(6-5-15(10)2)13-4-3-11(9-17)7-12(13)14/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | UYDOQSXBEQTJGV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|