C10H19ClN2O — CID 63609559
3-chloro-1-(3,4-dimethylpiperazin-1-yl)-2-methylpropan-1-one (PubChem CID 63609559) has the molecular formula C10H19ClN2O and a molecular weight of 218.73 g/mol. Its IUPAC name is 3-chloro-1-(3,4-dimethylpiperazin-1-yl)-2-methylpropan-1-one.
| Compound Name | 3-chloro-1-(3,4-dimethylpiperazin-1-yl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 63609559 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3-chloro-1-(3,4-dimethylpiperazin-1-yl)-2-methylpropan-1-one |
| SMILES | CC(CCl)C(=O)N1CCN(C)C(C)C1 |
| InChI | InChI=1S/C10H19ClN2O/c1-8(6-11)10(14)13-5-4-12(3)9(2)7-13/h8-9H,4-7H2,1-3H3 |
| InChIKey | UUIHXBXOIAGDSJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|