C17H37N3 — CID 63610035
N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)heptan-4-amine (PubChem CID 63610035) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)heptan-4-amine.
| Compound Name | N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)heptan-4-amine |
|---|---|
| PubChem CID | 63610035 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | N-propyl-3-(3,3,4-trimethylpiperazin-1-yl)heptan-4-amine |
| SMILES | CCCNC(CCC)C(CC)N1CCN(C)C(C)(C)C1 |
| InChI | InChI=1S/C17H37N3/c1-7-10-15(18-11-8-2)16(9-3)20-13-12-19(6)17(4,5)14-20/h15-16,18H,7-14H2,1-6H3 |
| InChIKey | SOUQVCPBYQTMSJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |