C16H26N4 — CID 63610075
3-(3-ethyl-4-methylpiperazin-1-yl)-3-phenylpropanimidamide (PubChem CID 63610075) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-(3-ethyl-4-methylpiperazin-1-yl)-3-phenylpropanimidamide.
| Compound Name | 3-(3-ethyl-4-methylpiperazin-1-yl)-3-phenylpropanimidamide |
|---|---|
| PubChem CID | 63610075 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 3-(3-ethyl-4-methylpiperazin-1-yl)-3-phenylpropanimidamide |
| SMILES | [H]/N=C(\N)CC(c1ccccc1)N1CCN(C)C(CC)C1 |
| InChI | InChI=1S/C16H26N4/c1-3-14-12-20(10-9-19(14)2)15(11-16(17)18)13-7-5-4-6-8-13/h4-8,14-15H,3,9-12H2,1-2H3,(H3,17,18) |
| InChIKey | VDBLWUKSICUDKZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|