C12H16Cl2N2 — CID 63611976
4,6-dichloro-5-methyl-2-(3-methylcyclohexyl)pyrimidine (PubChem CID 63611976) has the molecular formula C12H16Cl2N2 and a molecular weight of 259.18 g/mol. Its IUPAC name is 4,6-dichloro-5-methyl-2-(3-methylcyclohexyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-methyl-2-(3-methylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 63611976 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4,6-dichloro-5-methyl-2-(3-methylcyclohexyl)pyrimidine |
| SMILES | Cc1c(Cl)nc(C2CCCC(C)C2)nc1Cl |
| InChI | InChI=1S/C12H16Cl2N2/c1-7-4-3-5-9(6-7)12-15-10(13)8(2)11(14)16-12/h7,9H,3-6H2,1-2H3 |
| InChIKey | BLTLINQOESCTIY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |