C13H11BrCl2N2O — CID 63613498
2-(5-bromo-2-methoxyphenyl)-4,6-dichloro-5-ethylpyrimidine (PubChem CID 63613498) has the molecular formula C13H11BrCl2N2O and a molecular weight of 362.05 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-4,6-dichloro-5-ethylpyrimidine.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-4,6-dichloro-5-ethylpyrimidine |
|---|---|
| PubChem CID | 63613498 |
| Molecular Formula | C13H11BrCl2N2O |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-4,6-dichloro-5-ethylpyrimidine |
| SMILES | CCc1c(Cl)nc(-c2cc(Br)ccc2OC)nc1Cl |
| InChI | InChI=1S/C13H11BrCl2N2O/c1-3-8-11(15)17-13(18-12(8)16)9-6-7(14)4-5-10(9)19-2/h4-6H,3H2,1-2H3 |
| InChIKey | RZQFNIYMZYIALL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |