C17H25N3S — CID 63614822
2-cyclohexyl-6-ethyl-N-propylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 63614822) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is 2-cyclohexyl-6-ethyl-N-propylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-cyclohexyl-6-ethyl-N-propylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 63614822 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-cyclohexyl-6-ethyl-N-propylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCCNc1nc(C2CCCCC2)nc2sc(CC)cc12 |
| InChI | InChI=1S/C17H25N3S/c1-3-10-18-16-14-11-13(4-2)21-17(14)20-15(19-16)12-8-6-5-7-9-12/h11-12H,3-10H2,1-2H3,(H,18,19,20) |
| InChIKey | DNWQLMQRDYJFHU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |