C11H14N2O5 — CID 63614935
2-(2,2-dimethoxyethylcarbamoyl)pyridine-3-carboxylic acid (PubChem CID 63614935) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethylcarbamoyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(2,2-dimethoxyethylcarbamoyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63614935 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-(2,2-dimethoxyethylcarbamoyl)pyridine-3-carboxylic acid |
| SMILES | COC(CNC(=O)c1ncccc1C(=O)O)OC |
| InChI | InChI=1S/C11H14N2O5/c1-17-8(18-2)6-13-10(14)9-7(11(15)16)4-3-5-12-9/h3-5,8H,6H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | CXPGILPTHRISOS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|