C13H12FN3S — CID 63615475
5-ethyl-3-(6-fluoro-1H-benzimidazol-2-yl)thiophen-2-amine (PubChem CID 63615475) has the molecular formula C13H12FN3S and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-ethyl-3-(6-fluoro-1H-benzimidazol-2-yl)thiophen-2-amine.
| Compound Name | 5-ethyl-3-(6-fluoro-1H-benzimidazol-2-yl)thiophen-2-amine |
|---|---|
| PubChem CID | 63615475 |
| Molecular Formula | C13H12FN3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-ethyl-3-(6-fluoro-1H-benzimidazol-2-yl)thiophen-2-amine |
| SMILES | CCc1cc(-c2nc3ccc(F)cc3[nH]2)c(N)s1 |
| InChI | InChI=1S/C13H12FN3S/c1-2-8-6-9(12(15)18-8)13-16-10-4-3-7(14)5-11(10)17-13/h3-6H,2,15H2,1H3,(H,16,17) |
| InChIKey | YNQLIWVYANZKIG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |