About 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine
5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine (PubChem CID 63616303) has the molecular formula C10H14N4S
and a molecular weight of 222.32 g/mol. Its IUPAC name is 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine.
Molecular Properties
| Compound Name | 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine |
| PubChem CID | 63616303 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine |
| SMILES | CCc1cc(-c2ncnn2CC)c(N)s1 |
| InChI | InChI=1S/C10H14N4S/c1-3-7-5-8(9(11)15-7)10-12-6-13-14(10)4-2/h5-6H,3-4,11H2,1-2H3 |
| InChIKey | UBHZFUPXTOIMGQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine?
The IUPAC name of 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine (CID 63616303) is 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine.
What is the SMILES notation for 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine?
The canonical SMILES for 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine is CCc1cc(-c2ncnn2CC)c(N)s1.
What is the InChIKey of 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine?
The InChIKey is UBHZFUPXTOIMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4S/c1-3-7-5-8(9(11)15-7)10-12-6-13-14(10)4-2/h5-6H,3-4,11H2,1-2H3.
What are the key properties of 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine?
5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine has a molecular weight of 222.32 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-(2-ethyl-1,2,4-triazol-3-yl)thiophen-2-amine is sourced from PubChem (CID 63616303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).