C14H16N2O3S — CID 63616317
5-methyl-2-[(1-propylpyrrole-2-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 63616317) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 5-methyl-2-[(1-propylpyrrole-2-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 5-methyl-2-[(1-propylpyrrole-2-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63616317 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-methyl-2-[(1-propylpyrrole-2-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | CCCn1cccc1C(=O)Nc1sc(C)cc1C(=O)O |
| InChI | InChI=1S/C14H16N2O3S/c1-3-6-16-7-4-5-11(16)12(17)15-13-10(14(18)19)8-9(2)20-13/h4-5,7-8H,3,6H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | UPNWYOILQPALGB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |