C16H17N3O2 — CID 63616629
2-(2-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyridin-3-amine (PubChem CID 63616629) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(2-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 63616629 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-(2-ethoxyphenyl)-8-methoxyimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCOc1ccccc1-c1nc2c(OC)cccn2c1N |
| InChI | InChI=1S/C16H17N3O2/c1-3-21-12-8-5-4-7-11(12)14-15(17)19-10-6-9-13(20-2)16(19)18-14/h4-10H,3,17H2,1-2H3 |
| InChIKey | KGKCEZJQEUODSU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |