C12H16N4S — CID 63616717
1-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-amine (PubChem CID 63616717) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-amine.
| Compound Name | 1-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 63616717 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-(6-methylthieno[2,3-d]pyrimidin-4-yl)piperidin-4-amine |
| SMILES | Cc1cc2c(N3CCC(N)CC3)ncnc2s1 |
| InChI | InChI=1S/C12H16N4S/c1-8-6-10-11(14-7-15-12(10)17-8)16-4-2-9(13)3-5-16/h6-7,9H,2-5,13H2,1H3 |
| InChIKey | IGCBGRAHXKNTBN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |