About 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine
5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine (PubChem CID 63616765) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 63616765 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCCCCc1nc2cccc(C)n2c1N |
| InChI | InChI=1S/C13H19N3/c1-3-4-5-8-11-13(14)16-10(2)7-6-9-12(16)15-11/h6-7,9H,3-5,8,14H2,1-2H3 |
| InChIKey | NSKLBTHGHJJUTE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine (CID 63616765) is 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine is CCCCCc1nc2cccc(C)n2c1N.
What is the InChIKey of 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is NSKLBTHGHJJUTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-4-5-8-11-13(14)16-10(2)7-6-9-12(16)15-11/h6-7,9H,3-5,8,14H2,1-2H3.
What are the key properties of 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine?
5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 217.32 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 63616765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).