About 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine
6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine (PubChem CID 63616934) has the molecular formula C10H9Cl2N3
and a molecular weight of 242.11 g/mol. Its IUPAC name is 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 63616934 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Nc1c(C2CC2)nc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C10H9Cl2N3/c11-6-3-7(12)10-14-8(5-1-2-5)9(13)15(10)4-6/h3-5H,1-2,13H2 |
| InChIKey | ICYNNRHXALMDSE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine (CID 63616934) is 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine is Nc1c(C2CC2)nc2c(Cl)cc(Cl)cn12.
What is the InChIKey of 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is ICYNNRHXALMDSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9Cl2N3/c11-6-3-7(12)10-14-8(5-1-2-5)9(13)15(10)4-6/h3-5H,1-2,13H2.
What are the key properties of 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine?
6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 242.11 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-2-cyclopropylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 63616934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).