About 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol
2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol (PubChem CID 63616990) has the molecular formula C13H29NO3
and a molecular weight of 247.38 g/mol. Its IUPAC name is 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol |
| PubChem CID | 63616990 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol |
| SMILES | CCOC(CN(CCO)C(CC)CC)OCC |
| InChI | InChI=1S/C13H29NO3/c1-5-12(6-2)14(9-10-15)11-13(16-7-3)17-8-4/h12-13,15H,5-11H2,1-4H3 |
| InChIKey | GBGDBGUQTIKBJR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol?
The IUPAC name of 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol (CID 63616990) is 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol.
What is the SMILES notation for 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol?
The canonical SMILES for 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol is CCOC(CN(CCO)C(CC)CC)OCC.
What is the InChIKey of 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol?
The InChIKey is GBGDBGUQTIKBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NO3/c1-5-12(6-2)14(9-10-15)11-13(16-7-3)17-8-4/h12-13,15H,5-11H2,1-4H3.
What are the key properties of 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol?
2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol has a molecular weight of 247.38 g/mol, XLogP of 1.87, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-diethoxyethyl(pentan-3-yl)amino]ethanol is sourced from PubChem (CID 63616990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).