About [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine
[1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine (PubChem CID 63617163) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine |
| PubChem CID | 63617163 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine |
| SMILES | CCOC(CN1CCC(CN)C1)OCC |
| InChI | InChI=1S/C11H24N2O2/c1-3-14-11(15-4-2)9-13-6-5-10(7-12)8-13/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | YDWBIDPACPWZBO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine?
The IUPAC name of [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine (CID 63617163) is [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine is CCOC(CN1CCC(CN)C1)OCC.
What is the InChIKey of [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine?
The InChIKey is YDWBIDPACPWZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-3-14-11(15-4-2)9-13-6-5-10(7-12)8-13/h10-11H,3-9,12H2,1-2H3.
What are the key properties of [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine?
[1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine has a molecular weight of 216.32 g/mol, XLogP of 0.67, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-diethoxyethyl)pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 63617163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).