About 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole
2-(2,2-diethoxyethyl)-1,3-dihydroisoindole (PubChem CID 63617166) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole |
| PubChem CID | 63617166 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole |
| SMILES | CCOC(CN1Cc2ccccc2C1)OCC |
| InChI | InChI=1S/C14H21NO2/c1-3-16-14(17-4-2)11-15-9-12-7-5-6-8-13(12)10-15/h5-8,14H,3-4,9-11H2,1-2H3 |
| InChIKey | XXZVZASGZPQFAT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole?
The IUPAC name of 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole (CID 63617166) is 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole.
What is the SMILES notation for 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole?
The canonical SMILES for 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole is CCOC(CN1Cc2ccccc2C1)OCC.
What is the InChIKey of 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole?
The InChIKey is XXZVZASGZPQFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-3-16-14(17-4-2)11-15-9-12-7-5-6-8-13(12)10-15/h5-8,14H,3-4,9-11H2,1-2H3.
What are the key properties of 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole?
2-(2,2-diethoxyethyl)-1,3-dihydroisoindole has a molecular weight of 235.33 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethyl)-1,3-dihydroisoindole is sourced from PubChem (CID 63617166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).