C15H14FN3O2 — CID 63617289
2-(2,3-dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridin-3-amine (PubChem CID 63617289) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(2,3-dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 63617289 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-6-fluoroimidazo[1,2-a]pyridin-3-amine |
| SMILES | COc1cccc(-c2nc3ccc(F)cn3c2N)c1OC |
| InChI | InChI=1S/C15H14FN3O2/c1-20-11-5-3-4-10(14(11)21-2)13-15(17)19-8-9(16)6-7-12(19)18-13/h3-8H,17H2,1-2H3 |
| InChIKey | HWFOSUNXNGSPLD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |