C17H19N3O — CID 63617454
8-methyl-2-(3-propoxyphenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 63617454) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 8-methyl-2-(3-propoxyphenyl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | 8-methyl-2-(3-propoxyphenyl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 63617454 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 8-methyl-2-(3-propoxyphenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | CCCOc1cccc(-c2nc3c(C)cccn3c2N)c1 |
| InChI | InChI=1S/C17H19N3O/c1-3-10-21-14-8-4-7-13(11-14)15-16(18)20-9-5-6-12(2)17(20)19-15/h4-9,11H,3,10,18H2,1-2H3 |
| InChIKey | SHQQSVLYGYSYSY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |