C15H13N3O2 — CID 63618611
2-(1,3-benzodioxol-5-yl)-6-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 63618611) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-6-methylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-6-methylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 63618611 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-6-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1ccc2nc(-c3ccc4c(c3)OCO4)c(N)n2c1 |
| InChI | InChI=1S/C15H13N3O2/c1-9-2-5-13-17-14(15(16)18(13)7-9)10-3-4-11-12(6-10)20-8-19-11/h2-7H,8,16H2,1H3 |
| InChIKey | FUIBQHWQBRRIRC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |