C16H17N3 — CID 63619163
2-(4-ethylphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 63619163) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(4-ethylphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 63619163 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-(4-ethylphenyl)-7-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCc1ccc(-c2nc3cc(C)ccn3c2N)cc1 |
| InChI | InChI=1S/C16H17N3/c1-3-12-4-6-13(7-5-12)15-16(17)19-9-8-11(2)10-14(19)18-15/h4-10H,3,17H2,1-2H3 |
| InChIKey | QQYLGHBBFUMHEJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |