C13H26N2O — CID 63620255
2-[(3,4-dimethylpiperazin-1-yl)methyl]cyclohexan-1-ol (PubChem CID 63620255) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-[(3,4-dimethylpiperazin-1-yl)methyl]cyclohexan-1-ol.
| Compound Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 63620255 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 2-[(3,4-dimethylpiperazin-1-yl)methyl]cyclohexan-1-ol |
| SMILES | CC1CN(CC2CCCCC2O)CCN1C |
| InChI | InChI=1S/C13H26N2O/c1-11-9-15(8-7-14(11)2)10-12-5-3-4-6-13(12)16/h11-13,16H,3-10H2,1-2H3 |
| InChIKey | PRSWTIHWTQAGLY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |