C14H20ClN3S — CID 63620501
3-chloro-4-(3-ethyl-4-methylpiperazin-1-yl)benzenecarbothioamide (PubChem CID 63620501) has the molecular formula C14H20ClN3S and a molecular weight of 297.86 g/mol. Its IUPAC name is 3-chloro-4-(3-ethyl-4-methylpiperazin-1-yl)benzenecarbothioamide.
| Compound Name | 3-chloro-4-(3-ethyl-4-methylpiperazin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63620501 |
| Molecular Formula | C14H20ClN3S |
| Molecular Weight | 297.86 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-chloro-4-(3-ethyl-4-methylpiperazin-1-yl)benzenecarbothioamide |
| SMILES | CCC1CN(c2ccc(C(N)=S)cc2Cl)CCN1C |
| InChI | InChI=1S/C14H20ClN3S/c1-3-11-9-18(7-6-17(11)2)13-5-4-10(14(16)19)8-12(13)15/h4-5,8,11H,3,6-7,9H2,1-2H3,(H2,16,19) |
| InChIKey | UARLNSGXSRJEET-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.86 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|