C14H29N3O — CID 63620851
N-[2-(3,3,4-trimethylpiperazin-1-yl)ethyl]oxan-4-amine (PubChem CID 63620851) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is N-[2-(3,3,4-trimethylpiperazin-1-yl)ethyl]oxan-4-amine.
| Compound Name | N-[2-(3,3,4-trimethylpiperazin-1-yl)ethyl]oxan-4-amine |
|---|---|
| PubChem CID | 63620851 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | N-[2-(3,3,4-trimethylpiperazin-1-yl)ethyl]oxan-4-amine |
| SMILES | CN1CCN(CCNC2CCOCC2)CC1(C)C |
| InChI | InChI=1S/C14H29N3O/c1-14(2)12-17(9-8-16(14)3)7-6-15-13-4-10-18-11-5-13/h13,15H,4-12H2,1-3H3 |
| InChIKey | PUBXAPVPYHEGNR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |