C15H28N6 — CID 63621483
N-[[1-[2-(4-ethyl-3-methylpiperazin-1-yl)ethyl]triazol-4-yl]methyl]cyclopropanamine (PubChem CID 63621483) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is N-[[1-[2-(4-ethyl-3-methylpiperazin-1-yl)ethyl]triazol-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[2-(4-ethyl-3-methylpiperazin-1-yl)ethyl]triazol-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 63621483 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | N-[[1-[2-(4-ethyl-3-methylpiperazin-1-yl)ethyl]triazol-4-yl]methyl]cyclopropanamine |
| SMILES | CCN1CCN(CCn2cc(CNC3CC3)nn2)CC1C |
| InChI | InChI=1S/C15H28N6/c1-3-20-8-6-19(11-13(20)2)7-9-21-12-15(17-18-21)10-16-14-4-5-14/h12-14,16H,3-11H2,1-2H3 |
| InChIKey | NOOCOJGYINNLJT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |