C44H28FeN4 — CID 636234
iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide (PubChem CID 636234) has the molecular formula C44H28FeN4 and a molecular weight of 668.58 g/mol. Its IUPAC name is iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide.
| Compound Name | iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide |
|---|---|
| PubChem CID | 636234 |
| Molecular Formula | C44H28FeN4 |
| Molecular Weight | 668.58 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | iron(2+);5,10,15,20-tetraphenylporphyrin-22,24-diide |
| SMILES | C1=Cc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Fe+2] |
| InChI | InChI=1S/C44H28N4.Fe/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;/h1-28H;/q-2;+2/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | ZWYCMWUUWAFXIA-DAJBKUBHSA-N |
| XLogP | 10.58 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.58 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|