C17H23BrN2 — CID 63626581
N-(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 63626581) has the molecular formula C17H23BrN2 and a molecular weight of 335.29 g/mol. Its IUPAC name is N-(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 63626581 |
| Molecular Formula | C17H23BrN2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-(6-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | Brc1ccc2c(c1)CCC(NC1CCN3CCCC13)C2 |
| InChI | InChI=1S/C17H23BrN2/c18-14-5-3-13-11-15(6-4-12(13)10-14)19-16-7-9-20-8-1-2-17(16)20/h3,5,10,15-17,19H,1-2,4,6-9,11H2 |
| InChIKey | RMJJHBOHQQZTQY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |