C16H24BrN3O — CID 63627596
[5-bromo-2-(propylamino)-3-pyridinyl]-(4-methylazepan-1-yl)methanone (PubChem CID 63627596) has the molecular formula C16H24BrN3O and a molecular weight of 354.29 g/mol. Its IUPAC name is [5-bromo-2-(propylamino)-3-pyridinyl]-(4-methylazepan-1-yl)methanone.
| Compound Name | [5-bromo-2-(propylamino)-3-pyridinyl]-(4-methylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 63627596 |
| Molecular Formula | C16H24BrN3O |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [5-bromo-2-(propylamino)-3-pyridinyl]-(4-methylazepan-1-yl)methanone |
| SMILES | CCCNc1ncc(Br)cc1C(=O)N1CCCC(C)CC1 |
| InChI | InChI=1S/C16H24BrN3O/c1-3-7-18-15-14(10-13(17)11-19-15)16(21)20-8-4-5-12(2)6-9-20/h10-12H,3-9H2,1-2H3,(H,18,19) |
| InChIKey | NFOSQRQLRULWGB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |