C15H23N3O2S — CID 63627700
2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)piperidin-1-yl]ethanethioamide (PubChem CID 63627700) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)piperidin-1-yl]ethanethioamide.
| Compound Name | 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)piperidin-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 63627700 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)piperidin-1-yl]ethanethioamide |
| SMILES | NC(=S)CN1CCC(N2C(=O)C3CCCCC3C2=O)CC1 |
| InChI | InChI=1S/C15H23N3O2S/c16-13(21)9-17-7-5-10(6-8-17)18-14(19)11-3-1-2-4-12(11)15(18)20/h10-12H,1-9H2,(H2,16,21) |
| InChIKey | TURAEJWOIKKKSE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|