About 4-(2,2-diethoxyethoxy)oxane
4-(2,2-diethoxyethoxy)oxane (PubChem CID 63627894) has the molecular formula C11H22O4
and a molecular weight of 218.29 g/mol. Its IUPAC name is 4-(2,2-diethoxyethoxy)oxane.
Molecular Properties
| Compound Name | 4-(2,2-diethoxyethoxy)oxane |
| PubChem CID | 63627894 |
| Molecular Formula | C11H22O4 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 4-(2,2-diethoxyethoxy)oxane |
| SMILES | CCOC(COC1CCOCC1)OCC |
| InChI | InChI=1S/C11H22O4/c1-3-13-11(14-4-2)9-15-10-5-7-12-8-6-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | JUPBFILWYIPZKU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-diethoxyethoxy)oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-diethoxyethoxy)oxane?
The IUPAC name of 4-(2,2-diethoxyethoxy)oxane (CID 63627894) is 4-(2,2-diethoxyethoxy)oxane.
What is the SMILES notation for 4-(2,2-diethoxyethoxy)oxane?
The canonical SMILES for 4-(2,2-diethoxyethoxy)oxane is CCOC(COC1CCOCC1)OCC.
What is the InChIKey of 4-(2,2-diethoxyethoxy)oxane?
The InChIKey is JUPBFILWYIPZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O4/c1-3-13-11(14-4-2)9-15-10-5-7-12-8-6-10/h10-11H,3-9H2,1-2H3.
What are the key properties of 4-(2,2-diethoxyethoxy)oxane?
4-(2,2-diethoxyethoxy)oxane has a molecular weight of 218.29 g/mol, XLogP of 1.58, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-diethoxyethoxy)oxane is sourced from PubChem (CID 63627894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).